|
رمز HS |
280893 |
| Iupac Name | (Z)-3-[3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl]prop-2-enoic acid |
| Molecular Formula | C13H7F6N3O2 |
| Molecular Weight | 349.21 g/mol |
| Cas Number | 1198227-20-7 |
| Synonyms | (Z)-3-[3-(3,5-bis(trifluoromethyl)phenyl)-1H-1,2,4-triazol-1-yl]acrylic acid |
| Appearance | White to off-white solid |
| Smiles | C1=CC(=CC(=C1N2C=NN=C2)/C=C/C(=O)O)C(F)(F)F |
| Inchikey | YAYQZVRBKSPXFV-QPLCGJKRSA-N |
| Solubility | Soluble in DMSO and methanol |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك (Z)-3-(3-(3,5-Bis(Trifluoromethyl) Phenyl)-1H-1,2,4-Triazol-1-Yl)، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of (Z)-3-(3-(3,5 - Bis(trifluoromethyl)phenyl)-1H - 1,2,4 - triazol - 1 - yl)acrylic acid in sealed vial. |
| Storage | Store (Z)-3-(3-(3,5-Bis(trifluoromethyl)phenyl)-1H -1,2,4 -triazol-1-yl)acrylic acid in a cool, dry place, away from heat and direct sunlight. Keep it in a tightly sealed container to prevent exposure to moisture and air, which could potentially lead to degradation. Avoid storing near incompatible substances. |
| Shipping | The chemical (Z)-3-(3-(3,5 - Bis(trifluoromethyl)phenyl)-1H - 1,2,4 - triazol - 1 - yl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. Special handling per safety regulations for chemicals is ensured during transit. |
أسعار تنافسية لحمض الأكريليك (Z)-3-(3-(3,5-Bis(Trifluoromethyl) Phenyl)-1H-1,2,4-Triazol-1-Yl)تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
