|
رمز HS |
812862 |
| Iupac Name | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 1219801-51-6 |
| Appearance | Yellow to orange solid |
| Melting Point | Approx. 132-134°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1CC(CC=C1[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h4-5,7H,1-3,6H2,(H,11,12)/b5-4+ |
| Logp | 1.7 |
| Boiling Point | Decomposes before boiling |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, protected from light |
| Synonyms | trans-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك (E)-3-(5-Nitrocyclohex-1-En-1-Yl)، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of (E)-3-(5 - Nitrocyclohex - 1 - en - 1 - yl)acrylic acid in sealed chemical - grade bag. |
| Storage | (E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents and bases, to avoid chemical reactions. |
| Shipping | (E)-3-(5 - Nitrocyclohex-1-en-1-yl)acrylic acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills, in containers suitable for its chemical nature, and transported by approved carriers. |
أسعار تنافسية لحمض الأكريليك (E)-3-(5-Nitrocyclohex-1-En-1-Yl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com