|
رمز HS |
191865 |
| Product Name | (E)-3-(3,5-Dimethoxyphenyl)Acrylic Acid |
| Cas Number | 82639-36-9 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| Appearance | White to off-white solid |
| Melting Point | 145-149°C |
| Solubility | Slightly soluble in water, soluble in organic solvents such as ethanol and DMSO |
| Purity | Typically >98% |
| Smiles | COc1cc(cc(OC)c1)C=CC(=O)O |
| Inchi | InChI=1S/C11H12O4/c1-14-9-6-8(5-7-10(12)13)4-11(15-2)3-9/h4-7H,1-3H3,(H,12,13)/b7-5+ |
| Storage Temperature | 2-8°C (refrigerated) |
| Synonyms | trans-3-(3,5-Dimethoxyphenyl)acrylic acid |
باعتبارنا مصنعًا معتمدًا لحمض (E)-3-(3,5-Dimethoxyphenyl)Acrylic Acid، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (E)-3-(3,5 - Dimethoxyphenyl)Acrylic Acid in sealed, labeled chemical - grade bags. |
| Storage | (E)-3-(3,5 - Dimethoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances to avoid chemical reactions. |
| Shipping | ( E ) -3-(3,5 -Dimethoxyphenyl)Acrylic Acid is shipped in properly sealed, corrosion - resistant containers. Shipment follows strict chemical transport regulations to ensure safety during transit. |
أسعار تنافسية لحمض الأكريليك (E)-3-(3,5-Dimethoxyphenyl) تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com