|
رمز HS |
665624 |
| Cas Number | 614-19-7 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Iupac Name | 2-Phenylacrylic acid |
| Synonyms | Atropic acid, alpha-Phenylacrylic acid |
| Appearance | White to off-white crystalline powder |
| Melting Point | 104-106°C |
| Boiling Point | 277°C |
| Solubility In Water | Slightly soluble |
| Density | 1.155 g/cm³ |
| Smiles | C1=CC=C(C=C1)C=CC(=O)O |
| Inchi | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11) |
باعتبارنا مصنعًا معتمدًا لحمض الأتروبيك/حمض 2-فينيل أكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 1 kg of Atropic Acid/2 - Phenylacrylic Acid in sealed, chemical - resistant packaging. |
| Storage | Atropic acid/2 - Phenylacrylic acid should be stored in a cool, dry, well - ventilated area. Keep it away from heat, flames, and oxidizing agents. Store in a tightly - sealed container to prevent moisture absorption and degradation. It's advisable to store it separately from incompatible substances to avoid potential chemical reactions. |
| Shipping | Atropic Acid/2 - Phenylacrylic Acid is shipped in sealed, corrosion - resistant containers. These are carefully packaged to prevent leakage during transit, following strict chemical transportation safety regulations. |
أسعار تنافسية لحمض الأتروبيك/حمض 2-فينيل أكريليك تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com