|
رمز HS |
707209 |
| Chemical Name | 4-Fluorophenyl Acrylic Acid |
| Cas Number | 7695-41-2 |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.15 |
| Appearance | White to off-white solid |
| Melting Point | 169-172°C |
| Solubility | Slightly soluble in water |
| Pka | 4.45 |
| Smiles | C=CC1=CC=C(C=C1)F |
| Inchi | InChI=1S/C9H7FO2/c1-2-8-3-5-9(10)6-4-8/h2-7H,1H2 |
| Synonyms | 4-Fluorocinnamic acid |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك 4-فلورو فينيل، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of 4 - Fluorophenyl Acrylic Acid packaged in a sealed, chemical - resistant container. |
| Storage | 4 - Fluorophenyl Acrylic Acid should be stored in a cool, dry place, away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. Observe proper labeling for easy identification and safety. |
| Shipping | 4 - Fluorophenyl Acrylic Acid is shipped in well - sealed containers, compliant with chemical transportation regulations. It's carefully packaged to prevent spills and ensure safe transit, often via ground or air freight depending on quantity and urgency. |
أسعار تنافسية لحمض الأكريليك 4-فلورو فينيل تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
