|
رمز HS |
936910 |
| Product Name | 3B-Indole Acrylic Acid |
| Cas Number | 830-96-6 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Appearance | White to off-white powder |
| Melting Point | 153-156°C |
| Solubility | Slightly soluble in water, soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Storage Temperature | 2-8°C |
| Synonyms | Indole-3-acrylic acid, 3-Indoleacrylic acid |
| Pka | 4.6 (carboxyl group) |
| Smiles | C1=CC=C2C(=C1)C=CN2C=CC(=O)O |
| Application | Intermediate in organic synthesis and research |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك 3B-Indole، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100 - gram pack of 3 - Indole Acrylic Acid in air - tight, chemical - resistant packaging. |
| Storage | 3 - Indole Acrylic Acid should be stored in a cool, dry place, away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and incompatible substances. This helps maintain its chemical integrity and reduces the risk of degradation or dangerous reactions. |
| Shipping | 3 - Indole Acrylic Acid is shipped with strict adherence to chemical transport regulations. It's carefully packaged to prevent spills and damage, often in sealed containers. Shipment may involve temperature - controlled environments if required for stability. |
أسعار تنافسية لحمض الأكريليك 3B-Indole تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
