|
رمز HS |
555529 |
| Product Name | 3-Methoxyacrylic Acid Methyl Ester |
| Cas Number | 2706-99-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 128-130°C (at 760 mmHg) |
| Density | 1.065 g/cm3 (at 25°C) |
| Refractive Index | 1.422 (at 20°C) |
| Flash Point | 44°C |
| Purity | Typically ≥98% |
| Solubility | Soluble in organic solvents like ethanol and ether |
| Smiles | COC(=C)C(=O)OC |
| Inchi | InChI=1S/C5H8O3/c1-7-4-3-5(6)8-2/h3-4H,1-2H3 |
باعتبارنا مصنعًا معتمدًا لإنتاج ميثيل إستر حمض 3-ميثوكسي أكريليك، فإننا نطبق بروتوكولات جودة صارمة - حيث تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500 - gram bottles with tight - sealed caps for 3 - Methoxyacrylic Acid Methyl Ester. |
| Storage | 3 - Methoxyacrylic Acid Methyl Ester should be stored in a cool, dry, well - ventilated area, away from direct sunlight. Keep it in a tightly sealed container to prevent evaporation and contact with air. Store it separately from oxidizing agents and incompatible substances. Ensure storage temperature is maintained within a suitable range, typically around room temperature, to prevent decomposition. |
| Shipping | 3 - Methoxyacrylic Acid Methyl Ester is shipped in accordance with strict chemical transport regulations. It's typically packaged in sealed, corrosion - resistant containers. Shipments are carefully monitored for temperature and handling to ensure safety during transit. |
أسعار تنافسية لميثيل إستر حمض 3-ميثوكسي أكريليك تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com