|
رمز HS |
514083 |
| Chemical Name | 3-Furanylacrylic Acid |
| Cas Number | 609-97-8 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 148-150 °C |
| Solubility | Slightly soluble in water |
| Density | 1.371 g/cm3 |
| Pubchem Cid | 12611 |
| Smiles | C1=COC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O3/c8-7(9)3-6-2-1-5-10-6/h1-5H,(H,8,9) |
| Synonyms | 3-(Furan-3-yl)acrylic acid |
| Storage Conditions | Store at room temperature, tightly closed |
باعتبارنا مصنعًا معتمدًا لحمض 3-Furanylacrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of 3 - Furanylacrylic Acid packaged in a sealed, air - tight plastic bag. |
| Storage | 3 - Furanylacrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases. Ideal storage temperature is around room temperature, avoiding extreme hot or cold conditions. |
| Shipping | 3 - Furanylacrylic Acid is shipped in sealed, corrosion - resistant containers. Packaging ensures protection from moisture and physical damage. Shipments follow strict chemical transportation regulations for safe delivery. |
أسعار تنافسية لحمض 3-Furanylacrylic تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
