|
رمز HS |
831550 |
| Chemical Name | 3-Benzoylacrylic Acid |
| Cas Number | 614-61-9 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 |
| Appearance | White to off-white powder |
| Melting Point | 185-187°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Purity | Typically ≥98% |
| Storage Temperature | Store at 2-8°C |
| Synonyms | Benzalmalonic acid |
| Inchi | InChI=1S/C10H8O3/c11-9(7-8-4-2-1-3-5-8)6-10(12)13/h1-7H,(H,12,13) |
| Smiles | C1=CC=C(C=C1)C(=O)C=CC(=O)O |
| Assay Method | HPLC |
باعتبارنا مصنعًا معتمدًا لحمض 3-Benzoylacrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100 - gram pack of 3 - Benzoylacrylic Acid in sealed, chemical - resistant packaging. |
| Storage | 3 - Benzoylacrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | 3-Benzoylacrylic Acid is shipped in well - sealed containers, often lined to prevent contact with external elements. Shipment follows strict chemical transport regulations to ensure safety during transit, safeguarding both handlers and the environment. |
أسعار حمض 3-Benzoylacrylic تنافسية تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
