|
رمز HS |
787814 |
| Product Name | 3-(4-Nitrophenyl)Acrylic Acid |
| Cas Number | 104-91-6 |
| Molecular Formula | C9H7NO4 |
| Molecular Weight | 193.16 g/mol |
| Appearance | Yellow to orange powder |
| Melting Point | 202-204 °C |
| Solubility | Slightly soluble in water; soluble in ethanol and DMSO |
| Purity | Typically ≥98% |
| Iupac Name | (E)-3-(4-nitrophenyl)prop-2-enoic acid |
| Synonyms | p-Nitrocinnamic acid |
| Smiles | C1=CC(=CC=C1C=CC(=O)O)[N+](=O)[O-] |
| Inchikey | FBUBBHPXCVIZCF-UHFFFAOYSA-N |
| Storage Conditions | Store at room temperature, protected from moisture and light |
باعتبارنا مصنعًا معتمدًا لحمض 3-(4-نيتروفينيل) أكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of 3-(4 - Nitrophenyl)Acrylic Acid packaged in a sealed, chemical - resistant container. |
| Storage | 3-(4 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air. Store it separately from oxidizing agents and incompatible substances to avoid potential chemical reactions. Suitable storage temperature is typically around 2 - 8°C if possible for long - term stability. |
| Shipping | 3-(4 - Nitrophenyl)Acrylic Acid is shipped in accordance with chemical regulations. Packed securely in suitable containers, it's transported by carriers trained in handling hazardous chemicals to ensure safe and proper delivery. |
أسعار تنافسية لحمض الأكريليك 3-(4-نيتروفينيل) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
