|
رمز HS |
875699 |
| Productname | 3-(4-Chloro-3-Nitrophenyl)Acrylic Acid |
| Casnumber | 32727-66-3 |
| Molecularformula | C9H6ClNO4 |
| Molecularweight | 227.6 g/mol |
| Appearance | Yellow solid |
| Meltingpoint | 181-185 °C |
| Solubility | Slightly soluble in water |
| Purity | Typically ≥98% |
| Smiles | C1=CC(=C(C=C1Cl)N(=O)=O)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClNO4/c10-8-4-6(1-2-9(12)13)3-7(5-8)11(14)15/h1-5H,(H,12,13) |
| Storagetemperature | 2-8 °C |
| Synonyms | 4-Chloro-3-nitrocinnamic acid |
باعتبارنا مصنعًا معتمدًا لحمض 3-(4-كلورو-3-نيتروفينيل) الأكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing or reducing agents, to avoid chemical reactions. |
| Shipping | 3-(4 - Chloro - 3 - Nitrophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. Special handling precautions are taken due to its chemical nature, following strict regulations to ensure safe transportation. |
أسعار تنافسية لحمض الأكريليك 3-(4-كلورو-3-نيتروفينيل) تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
