|
رمز HS |
485792 |
| Chemical Name | 3-(4-Chloro-2-Fluorophenyl)Acrylic Acid |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.6 g/mol |
| Cas Number | 870718-85-3 |
| Appearance | White to off-white solid |
| Purity | Typically ≥98% |
| Solubility | Soluble in organic solvents (e.g., DMSO, methanol) |
| Storage Conditions | Store at room temperature, away from moisture and light |
| Smiles | C1=CC(=C(C=C1Cl)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H6ClFO2/c10-7-3-1-6(9(12)13)2-8(11)5-4-7/h1-5H,(H,12,13) |
باعتبارنا مصنعًا معتمدًا لحمض 3-(4-كلورو-2-فلوروفينيل) الأكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of 3-(4 - Chloro - 2 - Fluorophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(4 - Chloro - 2 - Fluorophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizers or bases, to ensure safety and maintain its chemical integrity. |
| Shipping | 3-(4 - Chloro - 2 - fluorophenyl)acrylic acid is shipped in properly sealed containers. It follows strict chemical transportation regulations to ensure safe transit, avoiding exposure to incompatible substances. |
أسعار تنافسية لحمض الأكريليك 3-(4-كلورو-2-فلوروفينيل) تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
