|
رمز HS |
282099 |
| Chemical Name | 3-[4-(Benzyloxy)Phenyl]Acrylic Acid |
| Cas Number | 13013-70-4 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 |
| Appearance | White to off-white solid |
| Melting Point | 166-170°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Purity | Typically ≥98% |
| Smiles | C1=CC=C(C=C1)COC2=CC=C(C=C2)C=CC(=O)O |
| Inchi | InChI=1S/C16H14O3/c17-16(18)9-10-14-6-8-15(9)19-12-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,17,18) |
| Storage Conditions | Keep in a cool, dry place, protected from light |
| Synonyms | 4-(Benzyloxy)cinnamic acid |
باعتبارنا مصنعًا معتمدًا لحمض 3-[4-(بنزيلوكسي) فينيل] أكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of 3 - [4-(Benzyloxy)phenyl]Acrylic Acid in sealed, chemical - resistant packaging. |
| Storage | 3 - [4 - (Benzyloxy)phenyl]acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent contact with moisture and air, which could potentially lead to degradation. Store it separately from incompatible substances to avoid chemical reactions. Ensure the storage area has good ventilation. |
| Shipping | 3-[4-(Benzyloxy)phenyl]Acrylic Acid is shipped in accordance with chemical safety regulations. Packed in suitable containers to prevent spillage, it's transported by approved carriers, ensuring proper handling during transit. |
أسعار تنافسية لحمض الأكريليك 3-[4-(بنزيلوكسي) فينيل] تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
