|
رمز HS |
167281 |
| Chemical Name | 3-(3-Pyridyl)acrylic acid |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Cas Number | 7406-77-9 |
| Appearance | White to off-white solid |
| Melting Point | 149-153°C |
| Solubility | Soluble in water and organic solvents |
| Smiles | C1=CC(=CN=C1)C=CC(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11) |
| Synonyms | beta-(3-Pyridyl)acrylic acid |
| Purity | Typically ≥98% |
| Storage Conditions | Store at room temperature in a dry place |
باعتبارنا مصنعًا معتمدًا لحمض 3-(3-بيريديل) الأكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of 3-(3 - Pyridyl)Acrylic Acid packaged in a sealed, chemical - resistant bag. |
| Storage | 3-(3 - Pyridyl)Acrylic Acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to ensure its stability and integrity over time. |
| Shipping | 3-(3 - Pyridyl)Acrylic Acid is shipped in well - sealed containers, safeguarded against physical damage. Transport follows strict chemical safety regulations, ensuring secure delivery to prevent any leakage or hazards during transit. |
أسعار تنافسية لحمض الأكريليك 3-(3-بيريديل) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
