|
رمز HS |
282500 |
| Productname | 3-(3-Furyl)Acrylic Acid |
| Casnumber | 614-59-5 |
| Molecularformula | C7H6O3 |
| Molecularweight | 138.12 g/mol |
| Appearance | White to beige crystalline powder |
| Meltingpoint | 189-193°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Density | 1.35 g/cm³ (approximate) |
| Purity | Typically ≥98% |
| Smiles | C1=COC=C1C=CC(=O)O |
| Inchi | InChI=1S/C7H6O3/c8-7(9)4-5-6-1-2-10-3-6/h1-5H,(H,8,9) |
| Synonyms | 3-(Furan-3-yl)acrylic acid |
| Storageconditions | Store at 2-8°C, protect from light and moisture |
| Pka | Approx. 4.3 |
باعتبارنا مصنعًا معتمدًا لحمض 3-(3-Furyl)Acrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of 3-(3 - Furyl)Acrylic Acid in a sealed, chemical - resistant bag. |
| Storage | 3-(3 - Furyl)Acrylic Acid should be stored in a cool, dry place, away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, like strong oxidizing agents. Ideal storage temperature is around 2 - 8 °C if long - term stability is required. |
| Shipping | 3-(3 - Furyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipments comply with all chemical transport regulations to ensure safe delivery. |
أسعار تنافسية لحمض الأكريليك 3-(3-Furyl) تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
