|
رمز HS |
516880 |
| Productname | 3-(3,5-Difluorophenyl)Acrylic Acid |
| Casnumber | 886762-63-0 |
| Molecularformula | C9H6F2O2 |
| Molecularweight | 184.14 |
| Appearance | White to off-white solid |
| Meltingpoint | 119-121°C |
| Purity | Typically >98% |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Smiles | C1=C(C=C(C=C1F)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H6F2O2/c10-7-4-6(5-8(11)3-7)2-1-9(12)13/h1-5H,(H,12,13) |
| Storagetemperature | 2-8°C |
| Synonyms | 3-(3,5-Difluorophenyl)propenoic acid |
باعتبارنا مصنعًا معتمدًا لحمض 3-(3,5-Difluorophenyl)Acrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100g of 3-(3,5 - Difluorophenyl)Acrylic Acid packaged in a sealed plastic bag. |
| Storage | 3-(3,5 - Difluorophenyl)Acrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent contact with air and moisture, which could potentially degrade the chemical. Store it separately from incompatible substances to avoid any chemical reactions. |
| Shipping | 3-(3,5 - Difluorophenyl)Acrylic Acid is shipped in properly sealed, corrosion - resistant containers. Packaging adheres to chemical transport regulations to ensure safe transit, protecting from physical damage and environmental exposure. |
أسعار تنافسية لحمض الأكريليك 3-(3,5-Difluorophenyl) تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com