|
رمز HS |
921485 |
| Chemical Name | 3-(1H-Indol-3-yl)acrylic acid |
| Synonyms | Indole-3-acrylic acid, 3-Indoleacrylic acid |
| Molecular Formula | C11H9NO2 |
| Molar Mass | 187.2 g/mol |
| Cas Number | 100-25-4 |
| Appearance | Off-white to light yellow powder |
| Melting Point | 194-196 °C |
| Solubility In Water | Slightly soluble |
| Structure Type | Aromatic carboxylic acid |
| Smiles | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
| Inchi | InChI=1S/C11H9NO2/c13-11(14)6-8-7-12-10-5-3-2-4-9(8)10/h2-7,12H,1H2,(H,13,14) |
| Storage Conditions | Store at room temperature, protected from light and moisture |
باعتبارنا مصنعًا معتمدًا لحمض 3-(1H-Indol-3-Yl)Acrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of 3-(1H - Indol - 3 - Yl)Acrylic Acid in a sealed, chemical - resistant bag. |
| Storage | 3-(1H - Indol - 3 - Yl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight and heat sources. Keep it in a tightly sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances to avoid chemical reactions. |
| Shipping | 3-(1H - Indol - 3 - Yl)Acrylic Acid is shipped in well - sealed containers, compliant with chemical transportation regulations. Care is taken to prevent exposure to moisture, heat, and physical damage during transit. |
أسعار حمض الأكريليك 3-(1H-Indol-3-Yl) التنافسية التي تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com