|
رمز HS |
838432 |
| Iupac Name | (2E)-3-(pyridin-3-yl)acrylic acid |
| Cas Number | 51762-05-9 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Appearance | White to off-white solid |
| Melting Point | 165-167°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CN=C1)/C=C/C(=O)O |
| Inchi | InChI=1S/C8H7NO2/c10-8(11)4-5-7-2-1-3-9-6-7/h1-6H,(H,10,11)/b5-4+ |
| Pubchem Cid | 166713 |
| Pka | 4.43 (carboxylic acid group) |
| Synonyms | β-(3-Pyridyl)acrylic acid; 3-Pyridylacrylic acid |
| Logp | 0.97 |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك (2E)-3-(بيريدين-3-Yl)، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(Pyridin-3-yl)acrylic acid in sealed, chemical - resistant bags. |
| Storage | (2E)-3-(Pyridin - 3 - yl)acrylic acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent contact with moisture and air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3-(Pyridin-3-yl)acrylic acid is shipped in well - sealed containers, compliant with chemical transport regulations. Special care is taken to prevent damage, with proper cushioning and secure packaging for safe transit. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(بيريدين-3-Yl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
