|
رمز HS |
183118 |
| Iupac Name | (2E)-3-Ethoxyacrylic acid |
| Cas Number | 53521-53-8 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Appearance | Colorless to pale yellow liquid |
| Boiling Point | 92-94 °C at 20 mmHg |
| Density | 1.096 g/cm³ (approximate) |
| Solubility In Water | Moderately soluble |
| Smiles | CCOC=CC(=O)O |
| Inchi | InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3,(H,6,7)/b4-3+ |
| Refractive Index | 1.440 (approximate) |
| Ec Number | 258-396-3 |
باعتبارنا مصنعًا معتمدًا لحمض (2E)-3-إيثوكسي أكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3 - Ethoxyacrylic Acid in a sealed, corrosion - resistant plastic bottle. |
| Storage | (2E)-3 - Ethoxyacrylic acid should be stored in a cool, dry, well - ventilated area, away from heat sources and ignition points. Keep it in a tightly sealed container to prevent contact with air and moisture, which could potentially cause degradation. Store it separately from incompatible substances like strong oxidizing agents and bases to avoid chemical reactions. |
| Shipping | (2E)-3 - Ethoxyacrylic Acid is shipped in carefully sealed, corrosion - resistant containers. Shipment adheres to strict chemical transportation regulations, ensuring safe transit to prevent spills and maintain product integrity. |
أسعار تنافسية لحمض (2E)-3-إيثوكسي أكريليك تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
