|
رمز HS |
317786 |
| Iupac Name | (2E)-3-(5-nitrocyclohex-1-en-1-yl)acrylic acid |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Cas Number | 119224-15-6 |
| Appearance | Solid (exact color may vary, typically off-white to light yellow) |
| Solubility | Slightly soluble in water, more soluble in organic solvents |
| Boiling Point | Decomposes before boiling |
| Smiles | C1CC(=CC(C1)[N+](=O)[O-])C=CC(=O)O |
| Inchi | InChI=1S/C9H11NO4/c11-9(12)5-6-7-3-1-2-4-8(7)10(13)14/h5-6H,1-4H2,(H,11,12)/b6-5+ |
| Pubchem Cid | 20071461 |
| Storage Conditions | Store in a cool, dry place, away from light and incompatible substances |
| Functional Groups | Nitro, carboxylic acid, alkene, cyclohexene |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك (2E)-3-(5-Nitrocyclohex-1-Enyl)، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | Packaging: 1 kg of (2E)-3-(5 - Nitrocyclohex - 1 - enyl)acrylic acid in airtight container. |
| Storage | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to chemical degradation. Store it separately from incompatible substances like strong oxidizers and bases to ensure safety. |
| Shipping | (2E)-3-(5-Nitrocyclohex-1-enyl)acrylic acid is shipped in properly sealed, corrosion - resistant containers. Shipment adheres to strict chemical transport regulations, ensuring safety during transit. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(5-Nitrocyclohex-1-Enyl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
