|
رمز HS |
574163 |
| Iupac Name | (2E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Cas Number | 1076196-53-8 |
| Appearance | White to off-white solid |
| Melting Point | 129-133°C |
| Solubility In Water | Slightly soluble |
| Smiles | COC1=CC(=C(C=C1)C=CC(=O)O)F |
| Inchi | InChI=1S/C10H9FO3/c1-14-9-5-7(2-3-10(12)13)4-8(11)6-9/h2-6H,1H3,(H,12,13)/b3-2+ |
| Storage Conditions | Store at 2-8°C, protect from light |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك (2E)-3-(4-Fluoro-3-Methoxyphenyl)Acrylic Acid، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(4 - Fluoro - 3 - Methoxyphenyl)Acrylic Acid in sealed plastic bags. |
| Storage | (2E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and incompatible substances to avoid potential chemical reactions. |
| Shipping | (2E)-3-(4-Fluoro-3-methoxyphenyl)acrylic acid is shipped in sealed, corrosion - resistant containers. Strict compliance with chemical transportation regulations ensures safe transit, protecting both handlers and the environment. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(4-Fluoro-3-Methoxyphenyl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com