|
رمز HS |
746657 |
| Iupac Name | (2E)-3-(4-Bromo-2-fluorophenyl)acrylic acid |
| Molecular Formula | C9H6BrFO2 |
| Molecular Weight | 245.05 g/mol |
| Cas Number | 885278-96-6 |
| Appearance | White to off-white solid |
| Melting Point | 156-160°C |
| Solubility | Slightly soluble in water, soluble in organic solvents like DMSO and methanol |
| Smiles | C1=CC(=C(C=C1Br)C=CC(=O)O)F |
| Inchi | InChI=1S/C9H6BrFO2/c10-7-3-1-6(9(12)13)4-8(7)11-5-2-9/h1-5H,(H,12,13)/b6-1+ |
| Purity | Typically ≥ 98% |
| Storage Temperature | 2-8°C |
| Synonyms | 4-Bromo-2-fluoro-cinnamic acid |
باعتبارنا مصنعًا معتمدًا لحمض (2E)-3-(4-Bromo-2-Fluorophenyl)Acrylic Acid، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(4 - Bromo - 2 - Fluorophenyl)Acrylic Acid in sealed chemical - grade bags. |
| Storage | (2E)-3-(4 - Bromo - 2 - fluorophenyl)acrylic acid should be stored in a cool, dry place away from heat sources and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents and bases. |
| Shipping | (2E)-3-(4 - Bromo - 2 - fluorophenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. Shipment follows strict chemical transport regulations, ensuring safety during transit to prevent any leakage or damage. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(4-Bromo-2-Fluorophenyl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
