|
رمز HS |
475587 |
| Iupac Name | (2E)-3-(4-Bromo-2-chlorophenyl)acrylic acid |
| Molecular Formula | C9H6BrClO2 |
| Molecular Weight | 261.50 |
| Cas Number | 141995-96-2 |
| Appearance | Off-white to light brown solid |
| Melting Point | 173-176°C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Br)Cl |
| Inchi | InChI=1S/C9H6BrClO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| Purity | Typically >98% |
| Storage Condition | Store at 2-8°C, protected from light |
باعتبارنا مصنعًا معتمدًا لحمض (2E)-3-(4-Bromo-2-Chlorophenyl)Acrylic Acid، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid in sealed, labeled containers. |
| Storage | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid should be stored in a cool, dry place away from direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizing agents or bases, to ensure its chemical stability. |
| Shipping | (2E)-3-(4 - Bromo - 2 - Chlorophenyl)Acrylic Acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safety during transit to prevent spills and environmental exposure. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(4-Bromo-2-Chlorophenyl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
