|
رمز HS |
699416 |
| Iupac Name | (2E)-3-(3-Methoxyphenyl)acrylic acid |
| Cas Number | 578-09-8 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| Appearance | White to off-white crystalline powder |
| Melting Point | 164-168°C |
| Solubility In Water | Slightly soluble |
| Smiles | COC1=CC=CC(=C1)C=CC(=O)O |
| Inchi | InChI=1S/C10H10O3/c1-13-9-5-2-3-8(6-9)4-7-10(11)12/h2-7H,1H3,(H,11,12)/b7-4+ |
باعتبارنا مصنعًا معتمدًا لحمض (2E)-3-(3-Methoxyphenyl)Acrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(3 - Methoxyphenyl)Acrylic Acid in a sealed, labeled chemical - grade container. |
| Storage | (2E)-3-(3 - Methoxyphenyl)acrylic acid should be stored in a cool, dry place away from heat and ignition sources. Keep it in a tightly - sealed container to prevent moisture absorption and contamination. Store it separately from oxidizing agents and bases, as it can react with them. Ideal storage temperature is around 2 - 8°C for long - term stability. |
| Shipping | (2E)-3-(3 - Methoxyphenyl)acrylic acid is shipped in well - sealed, corrosion - resistant containers. It adheres to strict chemical transportation regulations, ensuring safe transit to prevent any leakage or damage during shipping. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(3-Methoxyphenyl) تتناسب مع ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
