|
رمز HS |
808263 |
| Iupac Name | (2E)-3-(3-Fluorophenyl)acrylic acid |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.15 g/mol |
| Cas Number | 552308-36-4 |
| Appearance | White to off-white solid |
| Melting Point | 153-157 °C |
| Solubility In Water | Slightly soluble |
| Smiles | C1=CC(=CC(=C1)F)C=CC(=O)O |
| Inchi | InChI=1S/C9H7FO2/c10-8-4-1-3-7(6-8)2-5-9(11)12/h1-6H,(H,11,12)/b5-2+ |
| Purity | Typically ≥98% |
| Storage Temperature | Store at 2-8°C |
| Synonyms | 3-(3-Fluorophenyl)acrylic acid |
باعتبارنا مصنعًا معتمدًا لحمض (2E)-3-(3-فلوروفينيل) الأكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(3 - Fluorophenyl)Acrylic Acid in a sealed, chemical - resistant bag. |
| Storage | (2E)-3-(3-Fluorophenyl)acrylic acid should be stored in a cool, dry place, away from heat sources and direct sunlight. Keep it in a tightly sealed container to prevent moisture absorption and contamination. Store it separately from incompatible substances, such as strong oxidizing agents and bases, to avoid potential chemical reactions. |
| Shipping | (2E)-3-(3-Fluorophenyl)acrylic acid is shipped with careful packaging to prevent breakage. It's handled in accordance with chemical transport regulations, ensuring safe transit to the destination. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(3-فلوروفينيل) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
