|
رمز HS |
364388 |
| Iupac Name | (2E)-3-(3-chloro-4-fluorophenyl)prop-2-enoic acid |
| Cas Number | 885277-12-7 |
| Molecular Formula | C9H6ClFO2 |
| Molecular Weight | 200.59 |
| Appearance | White to off-white solid |
| Melting Point | 118-122°C |
| Solubility | Slightly soluble in water, soluble in organic solvents |
| Smiles | C1=CC(=C(C=C1C=CC(=O)O)Cl)F |
| Inchi | InChI=1S/C9H6ClFO2/c10-7-4-6(2-3-8(7)11)1-5-9(12)13/h1-5H,(H,12,13)/b5-1+ |
| Purity | Typically >98% |
| Storage Conditions | Store at 2-8°C, keep container tightly closed |
| Synonyms | 3-(3-chloro-4-fluorophenyl)acrylic acid |
باعتبارنا مصنعًا معتمدًا لحمض الأكريليك (2E)-3-(3-Chloro-4-Fluorophenyl)، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 500g of (2E)-3-(3 - Chloro - 4 - Fluorophenyl)Acrylic Acid in sealed plastic bags. |
| Storage | (2E)-3-(3 - Chloro - 4 - fluorophenyl)acrylic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. Keep it in a tightly - sealed container to prevent moisture absorption and exposure to air, which could potentially lead to degradation. Store it separately from incompatible substances, such as strong oxidizers or bases, to avoid chemical reactions. |
| Shipping | (2E)-3-(3 - Chloro - 4 - fluorophenyl)acrylic acid is shipped in accordance with chemical safety regulations. It's packaged securely to prevent leakage, transported by carriers experienced in handling such chemicals, ensuring proper storage during transit. |
أسعار تنافسية لحمض الأكريليك (2E)-3-(3-Chloro-4-Fluorophenyl) تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
