|
رمز HS |
760878 |
| Cas Number | 1443-98-7 |
| Molecular Formula | C7H6O2S |
| Molecular Weight | 154.19 |
| Iupac Name | 2-thiophen-2-ylprop-2-enoic acid |
| Appearance | White to beige powder |
| Melting Point | 143-146°C |
| Solubility | Slightly soluble in water |
| Density | 1.34 g/cm3 (estimated) |
| Smiles | C=CC(=O)O c1cccs1 |
| Inchi | InChI=1S/C7H6O2S/c8-7(9)4-5-6-2-1-3-10-6/h1-5H,(H,8,9) |
| Synonyms | 2-Thienylacrylic acid; (E)-3-(2-Thienyl)acrylic acid |
باعتبارنا مصنعًا معتمدًا لحمض 2-Thienylacrylic، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 2 - Thienylacrylic Acid packaged in 1 - kg bags for secure storage and transport. |
| Storage | 2 - Thienylacrylic acid should be stored in a cool, dry place away from heat and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to avoid chemical reactions. |
| Shipping | 2 - Thienylacrylic acid is shipped in well - sealed, corrosion - resistant containers. Adequate cushioning is used to prevent breakage. Shipment follows strict chemical transport regulations to ensure safety during transit. |
أسعار تنافسية لحمض 2-ثينيل أكريليك تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
