|
رمز HS |
410919 |
| Name | 2-Phenylhydracrylic Acid |
| Cas Number | 614-70-0 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Appearance | White to light yellow crystalline powder |
| Melting Point | 106-109°C |
| Boiling Point | 332.8°C at 760 mmHg |
| Density | 1.213 g/cm3 |
| Solubility In Water | Slightly soluble |
| Purity | Typically ≥98% |
| Smiles | C1=CC=CC=C1C(C(=O)O)=C |
| Inchi | InChI=1S/C9H8O2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-6H,1H2,(H,10,11) |
باعتبارنا مصنعًا معتمدًا لحمض 2-فينيل هيدرو أكريليك، فإننا نطبق بروتوكولات جودة صارمة - تخضع كل دفعة لاختبارات صارمة لضمان معايير الفعالية والسلامة المتسقة.
| Packing | 100 - gram bottle of 2 - Phenylhydracrylic Acid, securely packaged for safe transit. |
| Storage | 2 - Phenylhydracrylic Acid should be stored in a cool, dry place away from heat sources and direct sunlight. Keep it in a well - sealed container to prevent moisture absorption and contact with air, which could potentially lead to degradation. Store it separately from incompatible substances like strong oxidizing agents to avoid dangerous reactions. |
| Shipping | 2 - Phenylhydracrylic Acid is shipped in accordance with chemical transport regulations. Packed securely in suitable containers, it's transported by methods ensuring stability, avoiding exposure to incompatible substances, and meeting safety standards during transit. |
أسعار تنافسية لحامض 2-فينيل هيدراكريليك تناسب ميزانيتك - شروط مرنة وعروض أسعار مخصصة لكل طلب.
للحصول على عينات أو أسعار أو مزيد من المعلومات ، يرجى الاتصال بنا على+8615365186327 أو البريد إلى sales3@ascent-chem.com.
وسوف نقوم بالرد عليك في أقرب وقت ممكن.
تل: +8615365186327
البريد الإلكتروني: sales3@ascent-chem.com
